N-[(E)-cyclohex-3-en-1-ylmethylideneamino]pyridine-3-carboxamide structure
|
Common Name | N-[(E)-cyclohex-3-en-1-ylmethylideneamino]pyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5469-27-2 | Molecular Weight | 229.27800 | |
| Density | 1.16g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(E)-cyclohex-3-en-1-ylmethylideneamino]pyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.27800 |
| Exact Mass | 229.12200 |
| PSA | 57.84000 |
| LogP | 2.72830 |
| Index of Refraction | 1.602 |
| InChIKey | USZHYVSWSRGYDU-DHDCSXOGSA-N |
| SMILES | O=C(NN=CC1CC=CCC1)c1cccnc1 |
| HS Code | 2917190090 |
|---|
|
~%
N-[(E)-cyclohex... CAS#:5469-27-2 |
| Literature: Rappe,C.; Andersson,K. Acta Chemica Scandinavica (1947-1973), 1967 , vol. 21, p. 1741 - 1749 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-((1E)-2-cyclohex-3-enyl-1-azavinyl)-3-pyridylcarboxamide |
| 2-Brom-citraconsaeure-dimethylester |
| N'-[(E)-cyclohex-3-en-1-ylmethylidene]pyridine-3-carbohydrazide |
| Bromocitraconic-acid-dimethyl-ester |
| dimethyl 2-bromo-3-methylbutenedioate |
| cis-2-bromo-3-methylbutenedioic acid dimethyl ester |