1,4,5-triphenylpyrrolidine-2,3-dione structure
|
Common Name | 1,4,5-triphenylpyrrolidine-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5469-53-4 | Molecular Weight | 327.37600 | |
| Density | 1.233g/cm3 | Boiling Point | 483ºC at 760 mmHg | |
| Molecular Formula | C22H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.4ºC | |
| Name | 1,4,5-triphenylpyrrolidine-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 483ºC at 760 mmHg |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.37600 |
| Flash Point | 210.4ºC |
| Exact Mass | 327.12600 |
| PSA | 37.38000 |
| LogP | 4.19240 |
| Index of Refraction | 1.64 |
| InChIKey | CIAOQAUAMGXMOH-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)N(c2ccccc2)C(c2ccccc2)C1c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~%
1,4,5-triphenyl... CAS#:5469-53-4 |
| Literature: Vaughan; Covey Journal of the American Chemical Society, 1958 , vol. 80, p. 2197,2200 |
|
~%
1,4,5-triphenyl... CAS#:5469-53-4 |
| Literature: Borsche Chemische Berichte, 1909 , vol. 42, p. 4084 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4,5-Triphenyl-pyrrolidin-2,3-dion |
| HMS3093D13 |
| 1,4,5-Triphenyl-pyrrolidin-dion-(2,3) |
| 1,4,5-triphenyl-pyrrolidine-2,3-dione |