7,8-diphenyl-1,4-dioxa-8-azaspiro[4.4]nonan-9-one structure
|
Common Name | 7,8-diphenyl-1,4-dioxa-8-azaspiro[4.4]nonan-9-one | ||
|---|---|---|---|---|
| CAS Number | 5469-61-4 | Molecular Weight | 295.33200 | |
| Density | 1.29g/cm3 | Boiling Point | 530.3ºC at 760 mmHg | |
| Molecular Formula | C18H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.5ºC | |
| Name | 7,8-diphenyl-1,4-dioxa-7-azaspiro[4.4]nonan-6-one |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 530.3ºC at 760 mmHg |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.33200 |
| Flash Point | 274.5ºC |
| Exact Mass | 295.12100 |
| PSA | 38.77000 |
| LogP | 2.97270 |
| Index of Refraction | 1.645 |
| InChIKey | VXCDBXWIBXWSHN-UHFFFAOYSA-N |
| SMILES | O=C1N(c2ccccc2)C(c2ccccc2)CC12OCCO2 |
|
~%
7,8-diphenyl-1,... CAS#:5469-61-4 |
| Literature: Meyer; Vaughan Journal of Organic Chemistry, 1957 , vol. 22, p. 1560,1563 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |