ethyl 3-methyl-4,5-dioxo-1,2-diphenyl-pyrrolidine-3-carboxylate
Modify Date: 2024-04-02 22:40:05
ethyl 3-methyl-4,5-dioxo-1,2-diphenyl-pyrrolidine-3-carboxylate structure
|
Common Name | ethyl 3-methyl-4,5-dioxo-1,2-diphenyl-pyrrolidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5469-65-8 | Molecular Weight | 337.36900 | |
| Density | 1.232g/cm3 | Boiling Point | 464.9ºC at 760 mmHg | |
| Molecular Formula | C20H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235ºC | |
| Name | ethyl 3-methyl-4,5-dioxo-1,2-diphenylpyrrolidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 464.9ºC at 760 mmHg |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.36900 |
| Flash Point | 235ºC |
| Exact Mass | 337.13100 |
| PSA | 63.68000 |
| LogP | 2.97800 |
| Index of Refraction | 1.582 |
| InChIKey | MMXQYAFKZXRKPF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C)C(=O)C(=O)N(c2ccccc2)C1c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Dioxo-4-methyl-1,5-diphenyl-pyrrolidin-4-carbonsaeureethylester |
| 3-methyl-4,5-dioxo-1,2-diphenyl-pyrrolidine-3-carboxylic acid ethyl ester |
| 3-Methyl-4,5-dioxo-1,2-diphenyl-pyrrolidin-3-carbonsaeure-aethylester |
| ETHYL 3-METHYL-4,5-DIOXO-1,2-DIPHENYL-PYRROLIDINE-3-CARBOXYLATE |