4,5-diacetyloxypentyl acetate structure
|
Common Name | 4,5-diacetyloxypentyl acetate | ||
|---|---|---|---|---|
| CAS Number | 5470-86-0 | Molecular Weight | 246.25700 | |
| Density | 1.114g/cm3 | Boiling Point | 314.5ºC at 760 mmHg | |
| Molecular Formula | C11H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | 4,5-diacetyloxypentyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 314.5ºC at 760 mmHg |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.25700 |
| Flash Point | 134.7ºC |
| Exact Mass | 246.11000 |
| PSA | 78.90000 |
| LogP | 0.82450 |
| Index of Refraction | 1.44 |
| InChIKey | BRZLKIOVYHEWSE-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCCC(COC(C)=O)OC(C)=O |
| HS Code | 2915390090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1,5-diacetyloxypentan-2-yl acetate |
| pentane-1,2,5-triyl triacetate |
| 1,2,5-Triacetoxy-pentan |
| 4,5-diacetyloxypentyl ethanoate |
| 1,2,5-triacetoxypentane |