2-[2-ethyl-4-[(6-methoxyquinolin-8-yl)amino]butyl]isoindole-1,3-dione structure
|
Common Name | 2-[2-ethyl-4-[(6-methoxyquinolin-8-yl)amino]butyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5470-90-6 | Molecular Weight | 403.47400 | |
| Density | 1.253g/cm3 | Boiling Point | 610.7ºC at 760 mmHg | |
| Molecular Formula | C24H25N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.1ºC | |
| Name | 2-[2-ethyl-4-[(6-methoxyquinolin-8-yl)amino]butyl]isoindole-1,3-dione |
|---|
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 610.7ºC at 760 mmHg |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.47400 |
| Flash Point | 323.1ºC |
| Exact Mass | 403.19000 |
| PSA | 71.53000 |
| LogP | 4.37870 |
| Index of Refraction | 1.649 |
| InChIKey | IHIOLYLJIRZVKT-UHFFFAOYSA-N |
| SMILES | CCC(CCNc1cc(OC)cc2cccnc12)CN1C(=O)c2ccccc2C1=O |
|
~%
2-[2-ethyl-4-[(... CAS#:5470-90-6 |
| Literature: Elderfield et al. Journal of the American Chemical Society, vol. 77, p. 4819 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |