3-(3-methoxyphenyl)-1-phenyl-prop-2-en-1-one structure
|
Common Name | 3-(3-methoxyphenyl)-1-phenyl-prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 5470-91-7 | Molecular Weight | 238.28100 | |
| Density | 1.114g/cm3 | Boiling Point | 387.6ºC at 760 mmHg | |
| Molecular Formula | C16H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
| Name | 2-(2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 387.6ºC at 760 mmHg |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28100 |
| Flash Point | 174ºC |
| Exact Mass | 238.09900 |
| PSA | 26.30000 |
| LogP | 3.59130 |
| Index of Refraction | 1.606 |
| InChIKey | IWFHVAAFIDSBRL-KHPPLWFESA-N |
| SMILES | COc1cccc(C=CC(=O)c2ccccc2)c1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-Methoxy-chalkon |
| 4-methoxybenzalacetophenone |
| m-Methoxybenzalacetophenon |
| 3-methoxy-chalcone |