2-Pyrimidinamine,4,5,6-trichloro-N-methyl-N-phenyl- structure
|
Common Name | 2-Pyrimidinamine,4,5,6-trichloro-N-methyl-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5470-93-9 | Molecular Weight | 288.56000 | |
| Density | 1.469g/cm3 | Boiling Point | 419.6ºC at 760mmHg | |
| Molecular Formula | C11H8Cl3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
| Name | 2-(N-Tosyl-N-methyl)-aminobenzaldehyd |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 419.6ºC at 760mmHg |
| Molecular Formula | C11H8Cl3N3 |
| Molecular Weight | 288.56000 |
| Flash Point | 207.5ºC |
| Exact Mass | 286.97800 |
| PSA | 29.02000 |
| LogP | 4.20470 |
| Index of Refraction | 1.645 |
| InChIKey | JIEHWTLSEMCMGQ-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)c1nc(Cl)c(Cl)c(Cl)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Methyl 2-p-tosylaminobenzaldehyd |
| 2-(N-Methyl-phenylamino)-4,5,6-trichlorpyrimidin |
| methyl-phenyl-(2,4,6-trichloro-pyrimidin-2-yl)-amine |
| 2-(N-Methyl-N-tosylamino)benzaldehyd |
| Benzenesulfonamide,N-(2-formylphenyl)-N,4-dimethyl |