(4Z)-4-[[(4-iodophenyl)amino]methylidene]-N-(2-methoxyphenyl)-3-oxo-naphthalene-2-carboxamide structure
|
Common Name | (4Z)-4-[[(4-iodophenyl)amino]methylidene]-N-(2-methoxyphenyl)-3-oxo-naphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5471-07-8 | Molecular Weight | 325.27400 | |
| Density | 1.667g/cm3 | Boiling Point | 722.5ºC at 760 mmHg | |
| Molecular Formula | C14H26Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 390.8ºC | |
| Name | N-Bis-(2-chlor-ethyl)-benzamid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.667g/cm3 |
|---|---|
| Boiling Point | 722.5ºC at 760 mmHg |
| Molecular Formula | C14H26Cl2N2O2 |
| Molecular Weight | 325.27400 |
| Flash Point | 390.8ºC |
| Exact Mass | 324.13700 |
| PSA | 58.20000 |
| LogP | 3.59900 |
| Index of Refraction | 1.78 |
| InChIKey | CEFSJVISJVUTLK-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCCCC(=O)NCCCl)NCCCl |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-bis-(2-chloro-ethyl)-decanediamide |
| Sebacinsaeure-bis-(2-chlor-aethylamid) |
| N,N-Bis-(2-chlor-aethyl)-carbamoyl-L-glutamin-disaeureaethylester |
| bis(2-chloroethyl)benzoyl amine |
| N,N-Bis-(2-chlor-aethyl)-carbamyl-L-glutaminsaeure-diaethylester |
| N,N-bis-(2-chloro-ethyl)-benzamide |
| N,N'-Bis-(2-chlor-aethyl)-decandiamid |
| N,N-Bis-(2-chlor-aethyl)-benzamid |