3-(dimethylamino)-1-(4-methoxy-1-naphthyl)-1-propanone structure
|
Common Name | 3-(dimethylamino)-1-(4-methoxy-1-naphthyl)-1-propanone | ||
|---|---|---|---|---|
| CAS Number | 5471-09-0 | Molecular Weight | 293.78900 | |
| Density | 1.091g/cm3 | Boiling Point | 412.8ºC at 760 mmHg | |
| Molecular Formula | C16H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.5ºC | |
| Name | 3-(dimethylamino)-1-(4-methoxynaphthalen-1-yl)propan-1-one,hydrochloride |
|---|
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 412.8ºC at 760 mmHg |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.78900 |
| Flash Point | 203.5ºC |
| Exact Mass | 293.11800 |
| PSA | 29.54000 |
| LogP | 3.78480 |
| Index of Refraction | 1.579 |
| InChIKey | LDLYKYCTJMXHRV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCN(C)C)c2ccccc12.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |