Ethanone,1,2-bis(3-methoxyphenyl)-, oxime structure
|
Common Name | Ethanone,1,2-bis(3-methoxyphenyl)-, oxime | ||
|---|---|---|---|---|
| CAS Number | 5471-44-3 | Molecular Weight | 271.31100 | |
| Density | 1.1g/cm3 | Boiling Point | 453.5ºC at 760mmHg | |
| Molecular Formula | C16H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.1ºC | |
| Name | (NZ)-N-[1,2-bis(3-methoxyphenyl)ethylidene]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 453.5ºC at 760mmHg |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.31100 |
| Flash Point | 228.1ºC |
| Exact Mass | 271.12100 |
| PSA | 51.05000 |
| LogP | 3.12480 |
| Index of Refraction | 1.541 |
| InChIKey | GINLADCUPXZLCY-MSUUIHNZSA-N |
| SMILES | COc1cccc(CC(=NO)c2cccc(OC)c2)c1 |
| HS Code | 2928000090 |
|---|
|
~%
Ethanone,1,2-bi... CAS#:5471-44-3 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1945 , vol. 67, p. 1606 |
|
~%
Ethanone,1,2-bi... CAS#:5471-44-3 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1945 , vol. 67, p. 1606 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3,3'-Dimethoxy-desoxybenzoin |
| 3,3'-dimethoxy-deoxybenzoin |
| 3,3'-Dimethoxy-desoxybenzoin-oxim |
| 3,3'-dimethoxy-deoxybenzoin oxime |