1H-Azepinium,1,1'-(1,3-propanediyl)bis[hexahydro-1-methyl-, dibromide (9CI) structure
|
Common Name | 1H-Azepinium,1,1'-(1,3-propanediyl)bis[hexahydro-1-methyl-, dibromide (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5471-61-4 | Molecular Weight | 348.38500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H36BrN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-1-[3-(1-methylazepan-1-ium-1-yl)propyl]azepan-1-ium,dibromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H36BrN2+ |
|---|---|
| Molecular Weight | 348.38500 |
| Exact Mass | 347.20600 |
| LogP | 0.33930 |
| InChIKey | AFONKUHXHUWHSL-UHFFFAOYSA-M |
| SMILES | C[N+]1(CCC[N+]2(C)CCCCCC2)CCCCCC1.[Br-] |
|
~%
1H-Azepinium,1,... CAS#:5471-61-4 |
| Literature: Blicke; Hotelling Journal of the American Chemical Society, 1954 , vol. 76, p. 2422,2426 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1,1'-Dimethyl-dodecahydro-1,1'-propandiyl-bis-azepinium,Dibromid |
| 1,1'-Dimethyl-dodecahydro-1,1'-octandiyl-bis-azepinium,Dibromid |
| 1,1'-dimethyl-dodecahydro-1,1'-octanediyl-bis-azepinium,dibromide |
| 1,1'-Dimethyl-dodecahydro-1,1'-pentandiyl-bis-azepinium,Dibromid |
| 1,1'-dimethyl-dodecahydro-1,1'-propanediyl-bis-azepinium,dibromide |
| 1,1'-dimethyl-dodecahydro-1,1'-pentanediyl-bis-azepinium,dibromide |