Benzenamine,N,N-dimethyl-4-[2-(2-pyrazinyl)ethenyl]- structure
|
Common Name | Benzenamine,N,N-dimethyl-4-[2-(2-pyrazinyl)ethenyl]- | ||
|---|---|---|---|---|
| CAS Number | 5471-72-7 | Molecular Weight | 225.28900 | |
| Density | 1.143g/cm3 | Boiling Point | 374.2ºC at 760 mmHg | |
| Molecular Formula | C14H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.1ºC | |
| Name | 1-[4-hydroxy-1-(1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-4-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 374.2ºC at 760 mmHg |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.28900 |
| Flash Point | 180.1ºC |
| Exact Mass | 225.12700 |
| PSA | 29.02000 |
| LogP | 2.71300 |
| Index of Refraction | 1.676 |
| InChIKey | XSDKZBVEJBPEMZ-ZZXKWVIFSA-N |
| SMILES | CN(C)c1ccc(C=Cc2cnccn2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-<4-Dimethylamino-styryl>-pyrazin |