1-[3-(trifluoromethoxy)Phenyl]piperazine structure
|
Common Name | 1-[3-(trifluoromethoxy)Phenyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 54711-69-2 | Molecular Weight | 246.229 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 306.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H13F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.1±27.9 °C | |
| Name | 1-[3-(trifluoromethoxy)phenyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 306.4±42.0 °C at 760 mmHg |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.229 |
| Flash Point | 139.1±27.9 °C |
| Exact Mass | 246.097992 |
| PSA | 24.50000 |
| LogP | 2.05 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | ROLJHVUEZZXDFL-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Oc1cccc(N2CCNCC2)c1 |
|
~%
1-[3-(trifluoro... CAS#:54711-69-2 |
| Literature: MERCK and CO., INC. Patent: WO2007/70173 A2, 2007 ; Location in patent: Page/Page column 154-155 ; |
|
~%
1-[3-(trifluoro... CAS#:54711-69-2 |
| Literature: Foley, Timothy L.; Rai, Ganesha; Yasgar, Adam; Daniel, Thomas; Baker, Heather L.; Attene-Ramos, Matias; Kosa, Nicolas M.; Leister, William; Burkart, Michael D.; Jadhav, Ajit; Simeonov, Anton; Maloney, David J. Journal of Medicinal Chemistry, 2014 , vol. 57, # 3 p. 1063 - 1078 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(3-(Trifluoromethoxy)phenyl)piperazine |
| Piperazine,1-[3-(trifluoromethoxy)phenyl] |
| 1-[3-(Trifluoromethoxy)phenyl]piperazine |
| Piperazine, 1-[3-(trifluoromethoxy)phenyl]- |