N-(7-ethyl-1,2,3,4-tetrahydrophenanthren-9-yl)acetamide structure
|
Common Name | N-(7-ethyl-1,2,3,4-tetrahydrophenanthren-9-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 5472-21-9 | Molecular Weight | 267.36500 | |
| Density | 1.131g/cm3 | Boiling Point | 488ºC at 760 mmHg | |
| Molecular Formula | C18H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.6ºC | |
| Name | N-(7-ethyl-1,2,3,4-tetrahydrophenanthren-9-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.131g/cm3 |
|---|---|
| Boiling Point | 488ºC at 760 mmHg |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.36500 |
| Flash Point | 295.6ºC |
| Exact Mass | 267.16200 |
| PSA | 29.10000 |
| LogP | 4.31240 |
| Index of Refraction | 1.635 |
| InChIKey | BWWDHNIPRVBPGY-UHFFFAOYSA-N |
| SMILES | CCc1ccc2c3c(cc(NC(C)=O)c2c1)CCCC3 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 10-Acetamino-2-aethyl-5.6.7.8-tetrahydro-phenanthren |