6-amino-1,3-dimethyl-5-(methylamino)pyrimidine-2,4-dione structure
|
Common Name | 6-amino-1,3-dimethyl-5-(methylamino)pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 54729-62-3 | Molecular Weight | 184.19600 | |
| Density | 1.33 | Boiling Point | 261ºC | |
| Molecular Formula | C7H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112ºC | |
| Name | 6-amino-1,3-dimethyl-5-(methylamino)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33 |
|---|---|
| Boiling Point | 261ºC |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.19600 |
| Flash Point | 112ºC |
| Exact Mass | 184.09600 |
| PSA | 82.05000 |
| Index of Refraction | 1.598 |
| InChIKey | JSXYMTQGRNHHSA-UHFFFAOYSA-N |
| SMILES | CNc1c(N)n(C)c(=O)n(C)c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dimethyl-4-amino-5-methylamino-uracil |
| 1,3-dimethyl-5-methylamino-6-aminouracil |
| 6-amino-1,3-dimethyl-5-methylamino-1H-pyrimidine-2,4-dione |