N-butyl-N-(tributoxysilylmethyl)butan-1-amine structure
|
Common Name | N-butyl-N-(tributoxysilylmethyl)butan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 54729-92-9 | Molecular Weight | 389.68800 | |
| Density | 0.891g/cm3 | Boiling Point | 401ºC at 760 mmHg | |
| Molecular Formula | C21H47NO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.3ºC | |
| Name | N-butyl-N-(tributoxysilylmethyl)butan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.891g/cm3 |
|---|---|
| Boiling Point | 401ºC at 760 mmHg |
| Molecular Formula | C21H47NO3Si |
| Molecular Weight | 389.68800 |
| Flash Point | 196.3ºC |
| Exact Mass | 389.33300 |
| PSA | 30.93000 |
| LogP | 6.23510 |
| Index of Refraction | 1.447 |
| InChIKey | UEPDXOZOXRFEHP-UHFFFAOYSA-N |
| SMILES | CCCCO[Si](CN(CCCC)CCCC)(OCCCC)OCCCC |
| HS Code | 2931900090 |
|---|
|
~%
N-butyl-N-(trib... CAS#:54729-92-9 |
| Literature: Lukevits,E. et al. Pharmaceutical Chemistry Journal, 1974 , vol. 8, # 10 p. 611 - 613 Khimiko-Farmatsevticheskii Zhurnal, 1974 , vol. 8, # 10 p. 29 - 32 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| n-butyl-n-[(tributoxysilyl)methyl]butan-1-amine |