2,6-dinitro-4-trifluoromethylbenzenesulfonic acid structure
|
Common Name | 2,6-dinitro-4-trifluoromethylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 54729-99-6 | Molecular Weight | 316.16800 | |
| Density | 1.866g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H3F3N2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dinitro-4-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.866g/cm3 |
|---|---|
| Molecular Formula | C7H3F3N2O7S |
| Molecular Weight | 316.16800 |
| Exact Mass | 315.96100 |
| PSA | 154.39000 |
| LogP | 3.89570 |
| Index of Refraction | 1.552 |
| InChIKey | IVFGXTYRSDHGSH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1S(=O)(=O)O |
| HS Code | 2904909090 |
|---|
|
~%
2,6-dinitro-4-t... CAS#:54729-99-6 |
| Literature: Gerig,J.T.; Reinheimer,J.D. Journal of the American Chemical Society, 1975 , vol. 97, p. 168 - 173 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,6-Dinitro-tfmbsa |
| 2,6-Dinitro-4-trifluormethylbenzolsulphonat |
| Tfmdnps |
| 2,6-Dinitro-4-(trifluoromethyl)benzenesulfonic |
| 2,6-Dinitro-4-trifluormethylbenzolsulfonsaeure |