3-Chloro-4-nitro-1H-indazole structure
|
Common Name | 3-Chloro-4-nitro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 54768-47-7 | Molecular Weight | 197.579 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 415.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.9±23.2 °C | |
| Name | 3-chloro-4-nitro-2H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 415.2±25.0 °C at 760 mmHg |
| Molecular Formula | C7H4ClN3O2 |
| Molecular Weight | 197.579 |
| Flash Point | 204.9±23.2 °C |
| Exact Mass | 196.999207 |
| PSA | 74.50000 |
| LogP | 2.44 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.742 |
| InChIKey | GUGAGLJJSMABRQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2n[nH]c(Cl)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-chloro nitroindazole |
| 3-CHLORO-4-NITROINDAZOLE |
| 3-Chloro-4-nitro-1H-indazole |
| 1H-Indazole, 3-chloro-4-nitro- |