ethyl 2-cyano-2-methylsulfonyloxyiminoacetate structure
|
Common Name | ethyl 2-cyano-2-methylsulfonyloxyiminoacetate | ||
|---|---|---|---|---|
| CAS Number | 54769-21-0 | Molecular Weight | 220.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-cyano-2-methylsulfonyloxyiminoacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H8N2O5S |
|---|---|
| Molecular Weight | 220.20300 |
| Exact Mass | 220.01500 |
| PSA | 114.20000 |
| LogP | 0.48608 |
| InChIKey | YWOKHWQFDZLIOA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)=NOS(C)(=O)=O |
|
~%
ethyl 2-cyano-2... CAS#:54769-21-0 |
| Literature: Itoh,M. et al. Bulletin of the Chemical Society of Japan, 1978 , vol. 51, p. 3320 - 3329 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Ethyl 2-Methansulfonyloximino-2-cyanoacetat |
| Acetic acid,cyano[[(methylsulfonyl)oxy]imino]-,ethyl ester |
| 2-Methansulfonyloxyimino-2-cyanoessigsaeure-ethylester |