N-[(2-chloro-1-phenyl-indol-3-yl)methylideneamino]-2,4-dinitro-aniline structure
|
Common Name | N-[(2-chloro-1-phenyl-indol-3-yl)methylideneamino]-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 54778-18-6 | Molecular Weight | 435.82000 | |
| Density | 1.46g/cm3 | Boiling Point | 554ºC at 760 mmHg | |
| Molecular Formula | C21H14ClN5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.9ºC | |
| Name | N-[(2-chloro-1-phenylindol-3-yl)methylideneamino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 554ºC at 760 mmHg |
| Molecular Formula | C21H14ClN5O4 |
| Molecular Weight | 435.82000 |
| Flash Point | 288.9ºC |
| Exact Mass | 435.07300 |
| PSA | 120.96000 |
| LogP | 6.66570 |
| Index of Refraction | 1.703 |
| InChIKey | AWKCSEAUFJEXAL-QRVIBDJDSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2c(Cl)n(-c3ccccc3)c3ccccc23)c([N+](=O)[O-])c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-[(2-CHLORO-1-PHENYL-INDOL-3-YL)METHYLIDENEAMINO]-2,4-DINITRO-ANILINE |
| 2-Chlor-1-phenylindol-3-carbaldehyd-(2,4-dinitrophenylhydrazon) |