N-[1-(4-methylphenyl)ethylideneamino]aniline structure
|
Common Name | N-[1-(4-methylphenyl)ethylideneamino]aniline | ||
|---|---|---|---|---|
| CAS Number | 54779-81-6 | Molecular Weight | 224.30100 | |
| Density | 0.99g/cm3 | Boiling Point | 343.9ºC at 760 mmHg | |
| Molecular Formula | C15H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.8ºC | |
| Name | N-[1-(4-methylphenyl)ethylideneamino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 343.9ºC at 760 mmHg |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.30100 |
| Flash Point | 161.8ºC |
| Exact Mass | 224.13100 |
| PSA | 24.39000 |
| LogP | 3.90410 |
| Index of Refraction | 1.556 |
| InChIKey | MHDFJQMQUMBFQO-DTQAZKPQSA-N |
| SMILES | CC(=NNc1ccccc1)c1ccc(C)cc1 |
|
~97%
N-[1-(4-methylp... CAS#:54779-81-6 |
| Literature: Yadav, Urmiladevi Narad; Shankarling, Ganapati Subray Journal of Molecular Liquids, 2014 , vol. 191, p. 137 - 141 |
|
~%
N-[1-(4-methylp... CAS#:54779-81-6 |
| Literature: Li, Xi; Lu, Xiang; Xing, Man; Yang, Xian-Hui; Zhao, Ting-Ting; Gong, Hai-Bin; Zhu, Hai-Liang Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 11 p. 3589 - 3593 |
| phenylhydrazone of p-chloroacetophenone |
| p-methylacetophenone phenylhydrazone |
| 4-Methyl-acetophenon-phenylhydrazon |
| 4-methylacetophenone phenylhydrazone |
| phenylhydrazone of p-methylacetophenone |
| 4'-Chloroacetophenone phenylhydrazone |
| 1-p-Tolyl-aethanon-phenylhydrazon |
| p-chloroacetophenone phenylhydrazone |
| 1-p-tolyl-ethanone-phenylhydrazone |