4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | 4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 54792-21-1 | Molecular Weight | 354.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21Cl2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,4-dichlorophenoxy)butanoic acid,2-(2-hydroxyethylamino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H21Cl2NO5 |
|---|---|
| Molecular Weight | 354.22600 |
| Exact Mass | 353.08000 |
| PSA | 99.02000 |
| LogP | 2.18850 |
| InChIKey | IMKXPXLHRNNVHR-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCOc1ccc(Cl)cc1Cl.OCCNCCO |
| EINECS 259-353-6 |
| 4-(2,4-Dichlorophenoxy)butyric acid,compound with 2,2'-iminodiethanol (1:1) |