4-(Benzoyloxy)-2,5-bis(4-hydroxyphenyl)-3,6-dioxo-1,4-cyclohexadien-1-yl benzoate structure
|
Common Name | 4-(Benzoyloxy)-2,5-bis(4-hydroxyphenyl)-3,6-dioxo-1,4-cyclohexadien-1-yl benzoate | ||
|---|---|---|---|---|
| CAS Number | 548-32-3 | Molecular Weight | 532.49600 | |
| Density | 1.48g/cm3 | Boiling Point | 760.7ºC at 760 mmHg | |
| Molecular Formula | C32H20O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.6ºC | |
| Name | [4-benzoyloxy-2,5-bis(4-hydroxyphenyl)-3,6-dioxocyclohexa-1,4-dien-1-yl] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 760.7ºC at 760 mmHg |
| Molecular Formula | C32H20O8 |
| Molecular Weight | 532.49600 |
| Flash Point | 252.6ºC |
| Exact Mass | 532.11600 |
| PSA | 127.20000 |
| LogP | 5.08600 |
| Index of Refraction | 1.72 |
| InChIKey | UFFCRNVIKXMYLJ-UHFFFAOYSA-N |
| SMILES | O=C1C(OC(=O)c2ccccc2)=C(c2ccc(O)cc2)C(=O)C(OC(=O)c2ccccc2)=C1c1ccc(O)cc1 |
|
~%
4-(Benzoyloxy)-... CAS#:548-32-3 |
| Literature: Edwards,R.L.; Kale,N. Journal of the Chemical Society, 1964 , p. 4084 - 4085 |
|
~%
4-(Benzoyloxy)-... CAS#:548-32-3 |
| Literature: Besl, Helmut; Bresinsky, Andreas; Geigenmueller, Georg; Herrmann, Rupert; Kilpert, Claus; Steglich, Wolfgang Liebigs Annalen der Chemie, 1989 , p. 803 - 810 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,5-bis-benzoyloxy-3,6-bis-(4-hydroxy-phenyl)-[1,4]benzoquinone |
| 2,5-o,o-Dibenzoyl-atromentin) |
| Auranthiacin |
| AURANTIACIN |
| 2,5-Dibenzoyl-3,6-di-(4-hydroxy-phenyl)-<1,4>benzochinon |
| 4-(Benzoyloxy)-2,5-bis(4-hydroxyphenyl)-3,6-dioxo-1,4-cyclohexadien-1-yl benzoate |
| Aurantiacin,2,5-Dibenzoyloxy-3,6-bis-(4'-hydroxyphenyl)-1,4-benzochinon |
| 2,5-Dibenzoyloxy-3,6-di-(4-hydroxy-phenyl)-(1,4)-benzochinon |
| 2,5-Bis-benzoyloxy-3,6-bis-(4-hydroxy-phenyl)-[1,4]benzochinon |