1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile
1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile structure
|
Common Name | 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 54802-32-3 | Molecular Weight | 245.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19NO2 |
|---|---|
| Molecular Weight | 245.31700 |
| Exact Mass | 245.14200 |
| PSA | 42.25000 |
| LogP | 3.42928 |
| InChIKey | IHFYMHWPMTZZPJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(C#N)CCCCC2)cc1OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![1-[1-(3,4-Dimethoxyphenyl)cyclohexyl]methanamine structure](https://image.chemsrc.com/caspic/093/55092-70-1.png)
CAS#:55092-70-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(3,4-dimethoxy-phenyl)-cyclohexanecarbonitrile |
| 1-(3,4-Dimethoxyphenyl)cyclohexanecarbonitrile |
| 4-(3,4-dimethoxyphenyl)-4-cyanocyclohexane |
| 1-(3,4-Dimethoxyphenyl)-cyclohexan-1-carbonsaeurenitril |
| 1-(3,4-dimethoxyphenyl)-1-cyclohexylcarbonitrile |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile? |
| A: Related downstream products(CAS) of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile: 55092-70-1. |
| Q: What is the English name of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile? |
| A: The English name of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile is 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile. |
| Q: What is the SMILES notation of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile? |
| A: SMILES notation of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile is COc1ccc(C2(C#N)CCCCC2)cc1OC. |
| Q: What is the molecular weight of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile? |
| A: Molecular weight of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile is 245.31700. |
| Q: What is the LogP of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile? |
| A: LogP of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile is 3.42928. |
| Q: What is the polar surface area (PSA) of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile? |
| A: Polar surface area (PSA) of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile is 42.25000. |
| Q: What is the molecular formula of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile? |
| A: Molecular formula of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile is C15H19NO2. |
| Q: What English synonyms does 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile have? |
| A: English synonyms of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile: 1-(3,4-dimethoxy-phenyl)-cyclohexanecarbonitrile, 1-(3,4-Dimethoxyphenyl)cyclohexanecarbonitrile, 4-(3,4-dimethoxyphenyl)-4-cyanocyclohexane, 1-(3,4-Dimethoxyphenyl)-cyclohexan-1-carbonsaeurenitril, 1-(3,4-dimethoxyphenyl)-1-cyclohexylcarbonitrile. |
| Q: What is the Chinese name of 54802-32-3? |
| A: Chinese name of 54802-32-3 is 54802-32-3. |
| Q: What is the InChIKey of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile? |
| A: InChIKey of 1-(3,4-dimethoxyphenyl)cyclohexanecarbonitrile is IHFYMHWPMTZZPJ-UHFFFAOYSA-N. |