Benzoic acid, 4-amino-, 2- (diethylamino)ethyl ester, phosphate (1:1) structure
|
Common Name | Benzoic acid, 4-amino-, 2- (diethylamino)ethyl ester, phosphate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 54812-66-7 | Molecular Weight | 334.30500 | |
| Density | N/A | Boiling Point | 373.6ºC at 760 mmHg | |
| Molecular Formula | C13H23N2O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.8ºC | |
| Name | 2-(diethylamino)ethyl 4-aminobenzoate,phosphoric acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 373.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H23N2O6P |
| Molecular Weight | 334.30500 |
| Flash Point | 179.8ºC |
| Exact Mass | 334.12900 |
| PSA | 143.13000 |
| LogP | 1.42000 |
| InChIKey | NPBISBZNYVWJOL-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1.O=P(O)(O)O |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 259-358-3 |
| Procaine dihydrogen phosphate |
| Procaine phosphate |