Oxazole, 2,5-bis(4-nitrophenyl)
Modify Date: 2025-09-05 13:39:54
Oxazole, 2,5-bis(4-nitrophenyl) structure
|
Common Name | Oxazole, 2,5-bis(4-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 54814-29-8 | Molecular Weight | 311.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Oxazole, 2,5-bis(4-nitrophenyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H9N3O5 |
|---|---|
| Molecular Weight | 311.25 |
| InChIKey | NTZWKGGAODIHMS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2cnc(-c3ccc([N+](=O)[O-])cc3)o2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Oxazole, 2,5-bis(4-nitrophenyl)? |
| A: InChIKey of Oxazole, 2,5-bis(4-nitrophenyl) is NTZWKGGAODIHMS-UHFFFAOYSA-N. |
| Q: What is the English name of Oxazole, 2,5-bis(4-nitrophenyl)? |
| A: The English name of Oxazole, 2,5-bis(4-nitrophenyl) is Oxazole, 2,5-bis(4-nitrophenyl). |
| Q: What is the Chinese name of 54814-29-8? |
| A: Chinese name of 54814-29-8 is 54814-29-8. |
| Q: What is the SMILES notation of Oxazole, 2,5-bis(4-nitrophenyl)? |
| A: SMILES notation of Oxazole, 2,5-bis(4-nitrophenyl) is O=[N+]([O-])c1ccc(-c2cnc(-c3ccc([N+](=O)[O-])cc3)o2)cc1. |
| Q: What is the molecular weight of Oxazole, 2,5-bis(4-nitrophenyl)? |
| A: Molecular weight of Oxazole, 2,5-bis(4-nitrophenyl) is 311.25. |
| Q: What is the CAS number of Oxazole, 2,5-bis(4-nitrophenyl)? |
| A: CAS number of Oxazole, 2,5-bis(4-nitrophenyl) is 54814-29-8. |
| Q: What is the molecular formula of Oxazole, 2,5-bis(4-nitrophenyl)? |
| A: Molecular formula of Oxazole, 2,5-bis(4-nitrophenyl) is C15H9N3O5. |