Canellin C
Modify Date: 2026-06-28 08:38:41
Canellin C structure
|
Common Name | Canellin C | ||
|---|---|---|---|---|
| CAS Number | 54835-72-2 | Molecular Weight | 360.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Canellin C |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24O6 |
|---|---|
| Molecular Weight | 360.4 |
| InChIKey | HFRUTFXBVKAWAM-QOTPZCEWSA-N |
| SMILES | C[C@H]1[C@@H]([C@]2([C@@H](C(=O)C[C@@]1([C@H]2O)CC=C)O)OC)C3=CC4=C(C=C3)OCO4 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of DNA polymerase beta lyase activity
Source: ChEMBL
Target: DNA polymerase beta
External Id: CHEMBL999199
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Canellin C? |
| A: Molecular weight of Canellin C is 360.4. |
| Q: What is the Chinese name of 54835-72-2? |
| A: Chinese name of 54835-72-2 is 54835-72-2. |
| Q: What is the CAS number of Canellin C? |
| A: CAS number of Canellin C is 54835-72-2. |
| Q: What is the InChIKey of Canellin C? |
| A: InChIKey of Canellin C is HFRUTFXBVKAWAM-QOTPZCEWSA-N. |
| Q: What is the English name of Canellin C? |
| A: The English name of Canellin C is Canellin C. |
| Q: What is the molecular formula of Canellin C? |
| A: Molecular formula of Canellin C is C20H24O6. |
| Q: What is the SMILES notation of Canellin C? |
| A: SMILES notation of Canellin C is C[C@H]1[C@@H]([C@]2([C@@H](C(=O)C[C@@]1([C@H]2O)CC=C)O)OC)C3=CC4=C(C=C3)OCO4. |