(3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate
(3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate structure
|
Common Name | (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 548446-45-3 | Molecular Weight | 354.78700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (3-Acetamido-6-chloro-4-phenylquinolin-2-yl) acetate, CAS number 548446-45-3, molecular formula C19H15ClN2O3, molecular weight 354.79. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H15ClN2O3 |
|---|---|
| Molecular Weight | 354.78700 |
| Exact Mass | 354.07700 |
| PSA | 71.78000 |
| LogP | 5.08840 |
| InChIKey | ZZGXDCFMEDQFKA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(OC(C)=O)nc2ccc(Cl)cc2c1-c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~76%
(3-acetamido-6-... CAS#:548446-45-3 |
| Literature: Asis, Silvia E.; Bruno, Ana M.; Dominici, Diego A.; Bollini, Mariela; Gaozza, Carlos H. Journal of Heterocyclic Chemistry, 2003 , vol. 40, # 1 p. 107 - 112 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Acetic acid 3-acetylamino-6-chloro-4-phenyl-quinolin-2-yl ester |
| 2-acetamido-2-acetoxy-6-chloro-4-phenyl-quinoline |
| Acetamide,N-[2-(acetyloxy)-6-chloro-4-phenyl-3-quinolinyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate? |
| A: CAS number of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate is 548446-45-3. |
| Q: What is the Chinese name of 548446-45-3? |
| A: Chinese name of 548446-45-3 is 548446-45-3. |
| Q: What are the upstream materials of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate? |
| A: Related upstream materials(CAS) of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate: 108-24-7;5220-83-7. |
| Q: What is the polar surface area (PSA) of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate? |
| A: Polar surface area (PSA) of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate is 71.78000. |
| Q: What is the SMILES notation of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate? |
| A: SMILES notation of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate is CC(=O)Nc1c(OC(C)=O)nc2ccc(Cl)cc2c1-c1ccccc1. |
| Q: What is the molecular weight of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate? |
| A: Molecular weight of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate is 354.78700. |
| Q: What is the molecular formula of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate? |
| A: Molecular formula of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate is C19H15ClN2O3. |
| Q: What is the InChIKey of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate? |
| A: InChIKey of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate is ZZGXDCFMEDQFKA-UHFFFAOYSA-N. |
| Q: What is the English name of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate? |
| A: The English name of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate is (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate. |
| Q: What English synonyms does (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate have? |
| A: English synonyms of (3-acetamido-6-chloro-4-phenylquinolin-2-yl) acetate: Acetic acid 3-acetylamino-6-chloro-4-phenyl-quinolin-2-yl ester, 2-acetamido-2-acetoxy-6-chloro-4-phenyl-quinoline, Acetamide,N-[2-(acetyloxy)-6-chloro-4-phenyl-3-quinolinyl]. |