buquinolate structure
|
Common Name | buquinolate | ||
|---|---|---|---|---|
| CAS Number | 5486-03-3 | Molecular Weight | 361.43200 | |
| Density | 1.122g/cm3 | Boiling Point | 482.8ºC at 760mmHg | |
| Molecular Formula | C20H27NO5 | Melting Point | 288-291° | |
| MSDS | Chinese USA | Flash Point | 245.8ºC | |
| Name | ethyl 6,7-bis(2-methylpropoxy)-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 482.8ºC at 760mmHg |
| Melting Point | 288-291° |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.43200 |
| Flash Point | 245.8ºC |
| Exact Mass | 361.18900 |
| PSA | 77.88000 |
| LogP | 4.18670 |
| Index of Refraction | 1.521 |
| InChIKey | LVVXOXRUTDAKFE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c[nH]c2cc(OCC(C)C)c(OCC(C)C)cc2c1=O |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
[Determination of nequinate and buquinolate in livestock products using liquid chromatography-tandem mass spectrometry].
Shokuhin Eiseigaku Zasshi 52(3) , 178-82, (2011) We studied the simultaneous determination of nequinate and buquinolate, which are used as feed additives to prevent coccidiosis, by means of liquid chromatography coupled with tandem mass spectrometry... |
| Bukhinolyat |
| Bonaid |
| GNF-Pf-1188 |
| Ethyl-6,7-diisobutoxy-4-hydroxychinolin-3-carboxylat |
| Bonaid TM |
| BUQUINOLATE |
| component of Bonaid |
| EU-1093 |
| Ethyl-4-hydroxy-6,7-diisobutoxy-3-chinolincarboxylat |
| Butoril |