(2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine
(2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine structure
|
Common Name | (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 548762-64-7 | Molecular Weight | 248.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20N2O2 |
|---|---|
| Molecular Weight | 248.32100 |
| Exact Mass | 248.15200 |
| PSA | 41.57000 |
| LogP | 2.27210 |
| InChIKey | HDMXGKDIDQZITN-UHFFFAOYSA-N |
| SMILES | CC1CN(C(=O)OCc2ccccc2)C(C)CN1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:548762-66-9
CAS#:155836-78-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine? |
| A: InChIKey of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine is HDMXGKDIDQZITN-UHFFFAOYSA-N. |
| Q: What are the downstream products of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine? |
| A: Related downstream products(CAS) of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine: 548762-66-9;155836-78-5. |
| Q: What is the molecular formula of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine? |
| A: Molecular formula of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine is C14H20N2O2. |
| Q: What is the Chinese name of 548762-64-7? |
| A: Chinese name of 548762-64-7 is 548762-64-7. |
| Q: What is the polar surface area (PSA) of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine? |
| A: Polar surface area (PSA) of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine is 41.57000. |
| Q: What is the SMILES notation of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine? |
| A: SMILES notation of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine is CC1CN(C(=O)OCc2ccccc2)C(C)CN1. |
| Q: What is the CAS number of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine? |
| A: CAS number of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine is 548762-64-7. |
| Q: What is the molecular weight of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine? |
| A: Molecular weight of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine is 248.32100. |
| Q: What is the LogP of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine? |
| A: LogP of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine is 2.27210. |
| Q: What is the English name of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine? |
| A: The English name of (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine is (2R,5S)-1-benzyloxycarbonyl-2,5-dimethylpiperazine. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |