3-phenyloxirane-2-carboxylic acid
3-phenyloxirane-2-carboxylic acid structure
|
Common Name | 3-phenyloxirane-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 54885-10-8 | Molecular Weight | 187.14800 | |
| Density | 1.359g/cm3 | Boiling Point | 346.8ºC at 760mmHg | |
| Molecular Formula | C9H8NaO3+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 346.8ºC at 760mmHg |
| Molecular Formula | C9H8NaO3+ |
| Molecular Weight | 187.14800 |
| Flash Point | 147.2ºC |
| Exact Mass | 187.03700 |
| PSA | 49.83000 |
| LogP | 1.21110 |
| InChIKey | KBWMXVOEMPUTPU-WLYNEOFISA-N |
| SMILES | O=C(O)C1OC1c1ccccc1.[Na+] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:25957-39-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| trans-3-phenyl-oxiranecarboxylic acid,sodium salt |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid have? |
| A: English synonyms of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid: trans-3-phenyl-oxiranecarboxylic acid,sodium salt. |
| Q: What is the CAS number of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid? |
| A: CAS number of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid is 54885-10-8. |
| Q: What is the molecular weight of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid? |
| A: Molecular weight of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid is 187.14800. |
| Q: What is the LogP of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid? |
| A: LogP of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid is 1.21110. |
| Q: What is the SMILES notation of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid? |
| A: SMILES notation of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid is O=C(O)C1OC1c1ccccc1.[Na+]. |
| Q: What is the English name of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid? |
| A: The English name of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid is sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid. |
| Q: What is the molecular formula of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid? |
| A: Molecular formula of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid is C9H8NaO3+. |
| Q: What is the Chinese name of 54885-10-8? |
| A: Chinese name of 54885-10-8 is 54885-10-8. |
| Q: What are the downstream products of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid? |
| A: Related downstream products(CAS) of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid: 25957-39-5. |
| Q: What is the InChIKey of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid? |
| A: InChIKey of sodium,(2S,3R)-3-phenyloxirane-2-carboxylic acid is KBWMXVOEMPUTPU-WLYNEOFISA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |