Butane, 2,2-[ (2,2,2-trichloroethylidene)bis(oxy)]bis- structure
|
Common Name | Butane, 2,2-[ (2,2,2-trichloroethylidene)bis(oxy)]bis- | ||
|---|---|---|---|---|
| CAS Number | 54890-04-9 | Molecular Weight | 277.61600 | |
| Density | 1.148g/cm3 | Boiling Point | 285.9ºC at 760 mmHg | |
| Molecular Formula | C10H19Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.1ºC | |
| Name | 2-(1-butan-2-yloxy-2,2,2-trichloroethoxy)butane |
|---|
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 285.9ºC at 760 mmHg |
| Molecular Formula | C10H19Cl3O2 |
| Molecular Weight | 277.61600 |
| Flash Point | 87.1ºC |
| Exact Mass | 276.04500 |
| PSA | 18.46000 |
| LogP | 4.31290 |
| Index of Refraction | 1.46 |
| InChIKey | DKYJZZXSBAPULJ-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(OC(C)CC)C(Cl)(Cl)Cl |
| HS Code | 2909199090 |
|---|
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |