nitric acid,3-phenylpropan-1-ol structure
|
Common Name | nitric acid,3-phenylpropan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 54894-18-7 | Molecular Weight | 199.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Nitric acid,3-phenylpropan-1-ol (Chinese name: 3-苯基丙醇硝酸酯, CAS number: 54894-18-7, molecular formula: C9H13NO4, molecular weight: 199.20400), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | nitric acid,3-phenylpropan-1-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13NO4 |
|---|---|
| Molecular Weight | 199.20400 |
| Exact Mass | 199.08400 |
| PSA | 86.28000 |
| LogP | 1.78700 |
| InChIKey | BGCTZBKHSWGEKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCO.[N+](=O)(O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
nitric acid,3-p... CAS#:54894-18-7 |
| Literature: Cedona Pharmaceuticals B.V. Patent: US5049694 A1, 1991 ; |
|
~%
nitric acid,3-p... CAS#:54894-18-7 |
| Literature: McKillop,A.; Ford,M.E. Tetrahedron, 1974 , vol. 30, p. 2467 - 2475 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-phenylpropyl nitrate |
| Benzenepropanol,nitrate |
| 3-phenyl-1-propanol nitrate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of nitric acid,3-phenylpropan-1-ol? |
| A: InChIKey of nitric acid,3-phenylpropan-1-ol is BGCTZBKHSWGEKU-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of nitric acid,3-phenylpropan-1-ol? |
| A: Polar surface area (PSA) of nitric acid,3-phenylpropan-1-ol is 86.28000. |
| Q: What is the LogP of nitric acid,3-phenylpropan-1-ol? |
| A: LogP of nitric acid,3-phenylpropan-1-ol is 1.78700. |
| Q: What is the English name of nitric acid,3-phenylpropan-1-ol? |
| A: The English name of nitric acid,3-phenylpropan-1-ol is nitric acid,3-phenylpropan-1-ol. |
| Q: What is the Chinese name of 54894-18-7? |
| A: Chinese name of 54894-18-7 is 54894-18-7. |
| Q: What is the SMILES notation of nitric acid,3-phenylpropan-1-ol? |
| A: SMILES notation of nitric acid,3-phenylpropan-1-ol is C1=CC=C(C=C1)CCCO.[N+](=O)(O)[O-]. |
| Q: What is the molecular formula of nitric acid,3-phenylpropan-1-ol? |
| A: Molecular formula of nitric acid,3-phenylpropan-1-ol is C9H13NO4. |
| Q: What are the upstream materials of nitric acid,3-phenylpropan-1-ol? |
| A: Related upstream materials(CAS) of nitric acid,3-phenylpropan-1-ol: 122-97-4;637-59-2. |
| Q: What is the CAS number of nitric acid,3-phenylpropan-1-ol? |
| A: CAS number of nitric acid,3-phenylpropan-1-ol is 54894-18-7. |
| Q: What is the molecular weight of nitric acid,3-phenylpropan-1-ol? |
| A: Molecular weight of nitric acid,3-phenylpropan-1-ol is 199.20400. |