Uridine,2'-chloro-2'-deoxy-5-methyl- (9CI)
Modify Date: 2026-07-03 01:06:24
Uridine,2'-chloro-2'-deoxy-5-methyl- (9CI) structure
|
Common Name | Uridine,2'-chloro-2'-deoxy-5-methyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 54898-34-9 | Molecular Weight | 276.67 | |
| Density | 1.59g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H13ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Uridine,2'-chloro-2'-deoxy-5-methyl- (9CI)2’-Chlorothymidine is a thymidine analogue. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. |
| Name | 1-[(2R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | 2’-Chlorothymidine is a thymidine analogue. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.59g/cm3 |
|---|---|
| Molecular Formula | C10H13ClN2O5 |
| Molecular Weight | 276.67 |
| Exact Mass | 276.05100 |
| PSA | 104.55000 |
| Index of Refraction | 1.624 |
| InChIKey | WQMQACLYZYXSDZ-RLKNHCSUSA-N |
| SMILES | Cc1cn(C2OC(CO)C(O)C2Cl)c(=O)[nH]c1=O |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2'-Chlor-thymidin |
| 2'-Chloro-2'-deoxy-5-Methyluridine |
| 2'-chloro-5-methyl-2'-deoxy-uridine |
| 2'-Chlor-2'-deoxy-5-methyluridin |
| 2'-chlorothymidine |