2-benzoylamino-3,3-dichloro-acrylic acid
Modify Date: 2025-08-22 18:15:04
2-benzoylamino-3,3-dichloro-acrylic acid structure
|
Common Name | 2-benzoylamino-3,3-dichloro-acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 54902-23-7 | Molecular Weight | 260.07300 | |
| Density | 1.499g/cm3 | Boiling Point | 425.6ºC at 760 mmHg | |
| Molecular Formula | C10H7Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.2ºC | |
| Name | 2-benzoylamino-3,3-dichloro-acrylic acid |
|---|
| Density | 1.499g/cm3 |
|---|---|
| Boiling Point | 425.6ºC at 760 mmHg |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.07300 |
| Flash Point | 211.2ºC |
| Exact Mass | 258.98000 |
| PSA | 66.40000 |
| LogP | 2.53860 |
| Index of Refraction | 1.61 |
| InChIKey | NXZZZPFIONENKC-UHFFFAOYSA-N |
| SMILES | O=C(O)C(NC(=O)c1ccccc1)=C(Cl)Cl |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:54902-24-8| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |