ethyl 5-chloro-3-(2-ethoxycarbonylethyl)-1H-indole-2-carboxylate structure
|
Common Name | ethyl 5-chloro-3-(2-ethoxycarbonylethyl)-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 54904-12-0 | Molecular Weight | 323.77100 | |
| Density | 1.274g/cm3 | Boiling Point | 484.5ºC at 760 mmHg | |
| Molecular Formula | C16H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.8ºC | |
| Name | ethyl 5-chloro-3-(3-ethoxy-3-oxopropyl)-1H-indole-2-carboxylate |
|---|
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 484.5ºC at 760 mmHg |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.77100 |
| Flash Point | 246.8ºC |
| Exact Mass | 323.09200 |
| PSA | 68.39000 |
| LogP | 3.49370 |
| Index of Refraction | 1.584 |
| InChIKey | WNSWHEQRHLARJX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1c(C(=O)OCC)[nH]c2ccc(Cl)cc12 |
|
~87%
ethyl 5-chloro-... CAS#:54904-12-0 |
| Literature: Rossi, Silvano; Micheli, Marcello; Giannotti, Michele; Salvatori, Americo; Peruzzi, Guidubaldo Gazzetta Chimica Italiana, 1981 , vol. 111, # 7/8 p. 365 - 370 |
|
~%
ethyl 5-chloro-... CAS#:54904-12-0 |
| Literature: Rossi, Silvano; Micheli, Marcello; Giannotti, Michele; Salvatori, Americo; Peruzzi, Guidubaldo Gazzetta Chimica Italiana, 1981 , vol. 111, # 7/8 p. 365 - 370 |
|
~%
ethyl 5-chloro-... CAS#:54904-12-0 |
| Literature: Menciu, Cecilia; Duflos, Muriel; Fouchard, Fabienne; Le Baut, Guillaume; Emig, Peter; Achterrath, Ute; Szelenyi, Istvan; Nickel, Bernd; Schmidt, Juergen; Kutscher, Bernhard; Guenther, Eckhardt Journal of Medicinal Chemistry, 1999 , vol. 42, # 4 p. 638 - 648 |