(4-chlorophenyl)-(2-phenylimidazol-1-yl)methanone
Modify Date: 2025-09-28 20:21:58
(4-chlorophenyl)-(2-phenylimidazol-1-yl)methanone structure
|
Common Name | (4-chlorophenyl)-(2-phenylimidazol-1-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 54941-82-1 | Molecular Weight | 282.72400 | |
| Density | 1.24g/cm3 | Boiling Point | 483.4ºC at 760 mmHg | |
| Molecular Formula | C16H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.2ºC | |
| Name | (4-chlorophenyl)-(2-phenylimidazol-1-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 483.4ºC at 760 mmHg |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.72400 |
| Flash Point | 246.2ºC |
| Exact Mass | 282.05600 |
| PSA | 34.89000 |
| LogP | 3.89200 |
| Index of Refraction | 1.634 |
| InChIKey | YUJCWKIOCRLJEG-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)n1ccnc1-c1ccccc1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(p-Chlor-benzoyl)-2-phenyl-imidazol |
| 1H-Imidazole,1-(4-chlorobenzoyl)-2-phenyl |
| 1-(4-Chlorobenzoyl)-2-phenyl-1H-imidazole |