1,5,13,17,22-pentaazatricyclo[15.2.2.17,11]docosa-7,9,11(22)-triene-6,12-dione structure
|
Common Name | 1,5,13,17,22-pentaazatricyclo[15.2.2.17,11]docosa-7,9,11(22)-triene-6,12-dione | ||
|---|---|---|---|---|
| CAS Number | 54945-23-2 | Molecular Weight | 331.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5,13,17,22-pentaazatricyclo[15.2.2.17,11]docosa-7,9,11(22)-triene-6,12-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H25N5O2 |
|---|---|
| Molecular Weight | 331.41300 |
| Exact Mass | 331.20100 |
| PSA | 81.06000 |
| LogP | 0.16760 |
| InChIKey | PTLIDOZSZAHVJD-UHFFFAOYSA-N |
| SMILES | O=C1NCCCN2CCN(CCCNC(=O)c3cccc1n3)CC2 |
|
~23%
1,5,13,17,22-pe... CAS#:54945-23-2 |
| Literature: Alcock, Nathaniel W.; Moore, Peter; Reader, C. James; Roe, S. Mark Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1988 , p. 2959 - 2964 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6,12-dioxo-1,5,13,17,22-penta-azatricyclo-[15.2.2.17,11]docosa-7(22),8,10-triene |