Benzoic acid,2-[(4-propylphenyl)thio]
Modify Date: 2025-09-17 22:34:34
![Benzoic acid,2-[(4-propylphenyl)thio] Structure](https://www.chemsrc.com/extcaspic/195/5495-77-2.png)
Benzoic acid,2-[(4-propylphenyl)thio] structure
|
Common Name | Benzoic acid,2-[(4-propylphenyl)thio] | ||
|---|---|---|---|---|
| CAS Number | 5495-77-2 | Molecular Weight | 272.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzoic acid,2-[(4-propylphenyl)thio] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16O2S |
|---|---|
| Molecular Weight | 272.4 |
| InChIKey | NYSCDAFTTIUNLM-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(Sc2ccccc2C(=O)O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Benzoic acid,2-[(4-propylphenyl)thio]? |
| A: SMILES notation of Benzoic acid,2-[(4-propylphenyl)thio] is CCCc1ccc(Sc2ccccc2C(=O)O)cc1. |
| Q: What is the molecular weight of Benzoic acid,2-[(4-propylphenyl)thio]? |
| A: Molecular weight of Benzoic acid,2-[(4-propylphenyl)thio] is 272.4. |
| Q: What is the CAS number of Benzoic acid,2-[(4-propylphenyl)thio]? |
| A: CAS number of Benzoic acid,2-[(4-propylphenyl)thio] is 5495-77-2. |
| Q: What is the molecular formula of Benzoic acid,2-[(4-propylphenyl)thio]? |
| A: Molecular formula of Benzoic acid,2-[(4-propylphenyl)thio] is C16H16O2S. |
| Q: What is the InChIKey of Benzoic acid,2-[(4-propylphenyl)thio]? |
| A: InChIKey of Benzoic acid,2-[(4-propylphenyl)thio] is NYSCDAFTTIUNLM-UHFFFAOYSA-N. |
| Q: What is the English name of Benzoic acid,2-[(4-propylphenyl)thio]? |
| A: The English name of Benzoic acid,2-[(4-propylphenyl)thio] is Benzoic acid,2-[(4-propylphenyl)thio]. |
| Q: What is the Chinese name of 5495-77-2? |
| A: Chinese name of 5495-77-2 is 5495-77-2. |