(E)-5-dimethylamino-4-methyl-1-phenyl-pent-1-en-3-one structure
|
Common Name | (E)-5-dimethylamino-4-methyl-1-phenyl-pent-1-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 54951-56-3 | Molecular Weight | 253.76800 | |
| Density | 0.998g/cm3 | Boiling Point | 328.3ºC at 760 mmHg | |
| Molecular Formula | C14H20ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.1ºC | |
| Name | (E)-5-(dimethylamino)-4-methyl-1-phenylpent-1-en-3-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 0.998g/cm3 |
|---|---|
| Boiling Point | 328.3ºC at 760 mmHg |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.76800 |
| Flash Point | 114.1ºC |
| Exact Mass | 253.12300 |
| PSA | 20.31000 |
| LogP | 3.26860 |
| Index of Refraction | 1.546 |
| InChIKey | JHIRDSOLDBOSFB-RRABGKBLSA-N |
| SMILES | CC(CN(C)C)C(=O)C=Cc1ccccc1.Cl |
|
~50%
(E)-5-dimethyla... CAS#:54951-56-3 |
| Literature: Edwards, M.L.; Ritter, H.W.; Stemerick, D.M.; Stewart, K.T. Journal of Medicinal Chemistry, 1983 , vol. 26, # 3 p. 431 - 436 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-dimethylamino-4-methyl-2-phenyl-3-one hydrochloride |