1,4-bis-(Phenylmethyl)-2-piperazinecarboxylic acid methyl ester structure
|
Common Name | 1,4-bis-(Phenylmethyl)-2-piperazinecarboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 54969-33-4 | Molecular Weight | 324.41700 | |
| Density | 1.147 g/cm3 | Boiling Point | 428.916ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.201ºC | |
| Name | methyl 1,4-dibenzylpiperazine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147 g/cm3 |
|---|---|
| Boiling Point | 428.916ºC at 760 mmHg |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.41700 |
| Flash Point | 213.201ºC |
| Exact Mass | 324.18400 |
| PSA | 32.78000 |
| LogP | 2.42180 |
| Index of Refraction | 1.586 |
| InChIKey | DBMUXEJSBIDMQU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(Cc2ccccc2)CCN1Cc1ccccc1 |
| HS Code | 2933599090 |
|---|
|
~84%
1,4-bis-(Phenyl... CAS#:54969-33-4 |
| Literature: BAYER HEALTHCARE AG Patent: WO2004/84898 A1, 2004 ; Location in patent: Page/Page column 46-47 ; WO 2004/084898 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4-dibenzyl-piperazine-2-carboxylic acid methyl ester |