N2,N4-di-tert-butyl-6-(methylthio)-1,3,5-triazine-2,4-diamine structure
|
Common Name | N2,N4-di-tert-butyl-6-(methylthio)-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 5498-16-8 | Molecular Weight | 269.41000 | |
| Density | 1.09g/cm3 | Boiling Point | 413.5ºC at 760 mmHg | |
| Molecular Formula | C12H23N5S | Melting Point | 173 - 174 °C | |
| MSDS | N/A | Flash Point | 203.9ºC | |
| Name | N2,N4-di-tert-butyl-6-(methylthio)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 413.5ºC at 760 mmHg |
| Melting Point | 173 - 174 °C |
| Molecular Formula | C12H23N5S |
| Molecular Weight | 269.41000 |
| Flash Point | 203.9ºC |
| Exact Mass | 269.16700 |
| PSA | 88.03000 |
| LogP | 3.16030 |
| Index of Refraction | 1.54 |
| InChIKey | VONUTDHPPXOPTC-UHFFFAOYSA-N |
| SMILES | CSc1nc(NC(C)(C)C)nc(NC(C)(C)C)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| N,N'-di-tert-butyl-6-methylthio-s-triazine-2,4-diamine |
| N,N'-Bis(2-methyl-2-propanyl)-6-(methylsulfanyl)-1,3,5-triazine-2 ,4-diamine |