5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde
5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde structure
|
Common Name | 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 5499-69-4 | Molecular Weight | 229.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O |
|---|---|
| Molecular Weight | 229.27800 |
| Exact Mass | 229.12200 |
| PSA | 38.13000 |
| LogP | 2.05920 |
| InChIKey | NJDSPCHTYKBODV-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2ccccc2)c(N(C)C)c1C=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:62235-99-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Phenyl-3-methyl-5-dimethylaminopyrazol-4-aldehyd |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde? |
| A: Related downstream products(CAS) of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde: 62235-99-8. |
| Q: What English synonyms does 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde have? |
| A: English synonyms of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde: 1-Phenyl-3-methyl-5-dimethylaminopyrazol-4-aldehyd. |
| Q: What is the polar surface area (PSA) of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde? |
| A: Polar surface area (PSA) of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde is 38.13000. |
| Q: What is the InChIKey of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde? |
| A: InChIKey of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde is NJDSPCHTYKBODV-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 5499-69-4? |
| A: Chinese name of 5499-69-4 is 5499-69-4. |
| Q: What is the molecular formula of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde? |
| A: Molecular formula of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde is C13H15N3O. |
| Q: What is the molecular weight of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde? |
| A: Molecular weight of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde is 229.27800. |
| Q: What is the LogP of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde? |
| A: LogP of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde is 2.05920. |
| Q: What is the SMILES notation of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde? |
| A: SMILES notation of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde is Cc1nn(-c2ccccc2)c(N(C)C)c1C=O. |
| Q: What is the English name of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde? |
| A: The English name of 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde is 5-dimethylamino-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde. |