.beta.-(Diethylamino)ethyl 2-butoxy-3-aminobenzoate hydrochloride structure
|
Common Name | .beta.-(Diethylamino)ethyl 2-butoxy-3-aminobenzoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 550-01-6 | Molecular Weight | 344.87700 | |
| Density | 1.052g/cm3 | Boiling Point | 442.7ºC at 760 mmHg | |
| Molecular Formula | C17H29ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6ºC | |
| Name | 2-(diethylamino)ethyl 3-amino-2-butoxybenzoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 442.7ºC at 760 mmHg |
| Molecular Formula | C17H29ClN2O3 |
| Molecular Weight | 344.87700 |
| Flash Point | 221.6ºC |
| Exact Mass | 344.18700 |
| PSA | 64.79000 |
| LogP | 4.32950 |
| InChIKey | URLUCFXGWAZIMU-UHFFFAOYSA-N |
| SMILES | CCCCOc1c(N)cccc1C(=O)OCCN(CC)CC.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Primacaine |
| Metabutoxycaine hydrochloride |
| Metambucaine hydrochloride |
| Metabutoxycaine HCl |
| UNII-78WD7GMH3H |
| Primacaine hydrochloride |
| Methambucainehydrochloride |