2-(2,6-dioxopiperidin-3-yl)-5-nitroisoindoline-1,3-dione structure
|
Common Name | 2-(2,6-dioxopiperidin-3-yl)-5-nitroisoindoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 55003-81-1 | Molecular Weight | 303.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-(2,6-dioxopiperidin-3-yl)-5-nitroisoindoline-1,3-dioneCRBN ligand-9 (Compound 4d) is a CRBN ligand (Ki: 8.9 μM). CRBN ligand-9 can be used for synthesis of PROTACs[1][2]. |
| Name | 2-(2,6-dioxopiperidin-3-yl)-5-nitroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Description | CRBN ligand-9 (Compound 4d) is a CRBN ligand (Ki: 8.9 μM). CRBN ligand-9 can be used for synthesis of PROTACs[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H9N3O6 |
|---|---|
| Molecular Weight | 303.23 |
| Exact Mass | 303.04900 |
| PSA | 132.86000 |
| LogP | 0.73300 |
| InChIKey | MYPNWKPZEHVONN-UHFFFAOYSA-N |
| SMILES | O=C1CCC(N2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)C(=O)N1 |
| Storage condition | 2-8℃ |
| 4-nitrothalidomide |
| 2-(2,6-dioxo-3-piperidinyl)-5-nitro-1H-isoindole-1,3(2H)-dione |
| 2-(2,6-dioxo-piperidin-3-yl)-5-nitro-isoindole-1,3-dione |
| 1H-Isoindole-1,3(2H)-dione,2-(2,6-dioxo-3-piperidinyl)-5-nitro |
| 2-(4'-Nitro-phthalimido)-glutarimid |
| 1,3-dioxo-2-(2,6-dioxopiperidin-3-yl)-5-nitroisoindoline |
| N-(2,6-dioxopiperidin-3-yl)-4-nitrophthalimide |