2,2'-({2-[(4-Bromophenyl)amino]-2-oxoethyl}imino)diacetic acid structure
|
Common Name | 2,2'-({2-[(4-Bromophenyl)amino]-2-oxoethyl}imino)diacetic acid | ||
|---|---|---|---|---|
| CAS Number | 5502-60-3 | Molecular Weight | 345.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13BrN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[2-(4-bromoanilino)-2-oxoethyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13BrN2O5 |
|---|---|
| Molecular Weight | 345.14600 |
| Exact Mass | 344.00100 |
| PSA | 106.94000 |
| LogP | 0.93180 |
| InChIKey | PDCSCUOOLRQXQZ-UHFFFAOYSA-N |
| SMILES | O=C(O)CN(CC(=O)O)CC(=O)Nc1ccc(Br)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
2,2'-({2-[(4-Br... CAS#:5502-60-3 |
| Literature: Shtacher; Taub Journal of medicinal chemistry, 1966 , vol. 9, # 2 p. 197 - 203 |
|
~%
2,2'-({2-[(4-Br... CAS#:5502-60-3 |
| Literature: Shtacher; Taub Journal of medicinal chemistry, 1966 , vol. 9, # 2 p. 197 - 203 |
|
~%
2,2'-({2-[(4-Br... CAS#:5502-60-3 |
| Literature: Shtacher; Taub Journal of medicinal chemistry, 1966 , vol. 9, # 2 p. 197 - 203 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Glycine,N-[2-[(4-bromophenyl)amino]-2-oxoethyl]-N-(carboxymethyl) |
| N-(4-Brom-acetanilido)-iminodiessigsaeure |