Dexchlorpheniramine hydrochloride
Modify Date: 2026-07-16 17:46:50
Dexchlorpheniramine hydrochloride structure
|
Common Name | Dexchlorpheniramine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 5502-69-2 | Molecular Weight | 311.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dexchlorpheniramine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20Cl2N2 |
|---|---|
| Molecular Weight | 311.2 |
| InChIKey | NOXNCSQBTYNMHD-RSAXXLAASA-N |
| SMILES | CN(C)CCC(c1ccc(Cl)cc1)c1ccccn1.Cl |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 253, Current Page 1 of 26
1
2
3
4
5
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Dexchlorpheniramine hydrochloride? |
| A: The English name of Dexchlorpheniramine hydrochloride is Dexchlorpheniramine hydrochloride. |
| Q: What is the CAS number of Dexchlorpheniramine hydrochloride? |
| A: CAS number of Dexchlorpheniramine hydrochloride is 5502-69-2. |
| Q: What is the Chinese name of 5502-69-2? |
| A: Chinese name of 5502-69-2 is 5502-69-2. |
| Q: What is the molecular weight of Dexchlorpheniramine hydrochloride? |
| A: Molecular weight of Dexchlorpheniramine hydrochloride is 311.2. |
| Q: What is the SMILES notation of Dexchlorpheniramine hydrochloride? |
| A: SMILES notation of Dexchlorpheniramine hydrochloride is CN(C)CCC(c1ccc(Cl)cc1)c1ccccn1.Cl. |
| Q: What is the InChIKey of Dexchlorpheniramine hydrochloride? |
| A: InChIKey of Dexchlorpheniramine hydrochloride is NOXNCSQBTYNMHD-RSAXXLAASA-N. |
| Q: What is the molecular formula of Dexchlorpheniramine hydrochloride? |
| A: Molecular formula of Dexchlorpheniramine hydrochloride is C16H20Cl2N2. |