2-(Butyl-methyl-amino)-1-indan-5-yl-ethanol; compound with (Z)-but-2-enedioic acid structure
|
Common Name | 2-(Butyl-methyl-amino)-1-indan-5-yl-ethanol; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 55020-16-1 | Molecular Weight | 363.44800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H29NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(Butyl-methyl-amino)-1-indan-5-yl-ethanol; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C20H29NO5 |
|---|---|
| Molecular Weight | 363.44800 |
| Exact Mass | 363.20500 |
| PSA | 98.07000 |
| LogP | 2.65240 |
| InChIKey | CTKBLCKUFJQYRI-BTJKTKAUSA-N |
| SMILES | CCCCN(C)CC(O)c1ccc2c(c1)CCC2.O=C(O)C=CC(=O)O |