2-Phenyloxazoline-4-carboxylic acid methyl ester
2-Phenyloxazoline-4-carboxylic acid methyl ester structure
|
Common Name | 2-Phenyloxazoline-4-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 55044-06-9 | Molecular Weight | 205.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO3 |
|---|---|
| Molecular Weight | 205.21000 |
| Exact Mass | 205.07400 |
| PSA | 47.89000 |
| LogP | 0.44060 |
| InChIKey | DVPGDAXTDJUMAS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1COC(c2ccccc2)=N1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 7 | |
CAS#:92-71-7
CAS#:2549-35-1
CAS#:25755-94-6
CAS#:23012-16-0
CAS#:20771-08-8
CAS#:59171-72-1
CAS#:59398-98-0This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of UDP-3-O-[R-3-hydroxymyristoyl]-GlcNAc deacetylase using direct deacetyl...
Source: ChEMBL
Target: N/A
External Id: CHEMBL816288
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate? |
| A: InChIKey of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate is DVPGDAXTDJUMAS-UHFFFAOYSA-N. |
| Q: What is the English name of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate? |
| A: The English name of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate is methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate. |
| Q: What are the downstream products of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate? |
| A: Related downstream products(CAS) of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate: 92-71-7;2549-35-1;25755-94-6;23012-16-0;20771-08-8;59171-72-1;59398-98-0. |
| Q: What is the Chinese name of 55044-06-9? |
| A: Chinese name of 55044-06-9 is 55044-06-9. |
| Q: What is the LogP of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate? |
| A: LogP of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate is 0.44060. |
| Q: What is the molecular weight of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate? |
| A: Molecular weight of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate is 205.21000. |
| Q: What is the CAS number of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate? |
| A: CAS number of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate is 55044-06-9. |
| Q: What is the SMILES notation of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate? |
| A: SMILES notation of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate is COC(=O)C1COC(c2ccccc2)=N1. |
| Q: What is the polar surface area (PSA) of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate? |
| A: Polar surface area (PSA) of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate is 47.89000. |
| Q: What is the molecular formula of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate? |
| A: Molecular formula of methyl 2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate is C11H11NO3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |